|
 |
| |
Glycerol triacetate (foundry grade) |
Molecular formula: |
C9H14O6 |
Molecular weight: |
218.21 |
CAS No.: |
102-76-1 |
Structural formula: |
CH3COOCH2CH(CH3COO)CH2(CH3COO) |
Alias: |
Triacetin |
Assay: |
≥98% |
Use: |
This product is mainly used in selfhardening sodium silicate sand molding curing agent in foundry industry. Also can be used as plasticizer and so on. |
Packing: |
240kg iron drum. |
Quality standard: |
Item |
Unit |
Index |
Appearance |
|
Light-colored odorless oily viscous liquid |
Acidity |
% As HAc |
≤0.1 |
Moisture |
% |
≤0.2 |
Color |
Pt-Co |
≤30 |
Glycerol triacetate content |
% |
≥ 98.0 |
|
|
|
|